CAS 51550-04-0

3-(prop-2-en-1-yl)-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one

Description:

3-(Prop-2-en-1-yl)-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one, with the CAS number 51550-04-0, is a heterocyclic compound featuring a thieno-pyrimidine core. This compound is characterized by the presence of a thioxo group, which contributes to its reactivity and potential biological activity. The structure includes a prop-2-en-1-yl substituent, indicating the presence of an alkene, which may enhance its chemical reactivity and influence its interactions with biological targets. The thieno-pyrimidine framework is known for its diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its thioxo group can participate in various chemical reactions, such as nucleophilic attacks, and may also play a role in the compound's ability to form coordination complexes. Overall, this compound's unique structural features suggest potential applications in drug development and other fields of chemistry, although specific biological activities and applications would require further investigation.

Formula: C₉H₈N₂OS₂

InChI: InChI=1/C9H8N2OS2/c1-2-4-11-8(12)6-3-5-14-7(6)10-9(11)13/h2-3,5H,1,4H2,(H,10,13)

SMILES: C=CCn1c(=O)c2ccsc2nc1S

Synonyms:

• 3-allyl-2-mercaptothieno[2,3-d]pyrimidin-4(3H)-one
• 3-Allyl-2-sulfanylthieno[2,3-d]pyrimidin-4(3H)-one
• thieno[2,3-d]pyrimidin-4(3H)-one, 2-mercapto-3-(2-propen-1-yl)-

3-(Prop-2-en-1-yl)-2-sulfanyl-3H,4H-thieno[2,3-d]pyrimidin-4-one

CAS: 51550-04-0

Versatile small molecule scaffold

Formula: C₉H₈N₂OS₂

Purity: Min. 95%

Molecular weight: 224.3 g/mol

Ref: 3D-BCA55004