CAS 5156-22-9
:leu-trp
Description:
The chemical substance known as "leu-trp," with the CAS number 5156-22-9, is a dipeptide composed of the amino acids leucine (Leu) and tryptophan (Trp). Dipeptides are formed through peptide bonds between the carboxyl group of one amino acid and the amino group of another, resulting in a compound that retains the functional properties of its constituent amino acids. Leu-trp is characterized by its hydrophobic nature due to the presence of leucine, which can influence its solubility and interaction with biological membranes. Tryptophan contributes to the aromatic properties of the dipeptide, which can affect its role in protein structure and function. This dipeptide may play a role in various biological processes, including protein synthesis and signaling pathways. Additionally, it can be involved in the synthesis of neurotransmitters and other bioactive compounds. As with many peptides, its stability and activity can be influenced by environmental conditions such as pH and temperature.
Formula:C17H23N3O3
InChI:InChI=1/C17H23N3O3/c1-10(2)7-13(18)16(21)20-15(17(22)23)8-11-9-19-14-6-4-3-5-12(11)14/h3-6,9-10,13,15,19H,7-8,18H2,1-2H3,(H,20,21)(H,22,23)
SMILES:CC(C)CC(C(=NC(Cc1c[nH]c2ccccc12)C(=O)O)O)N
Synonyms:- H-Leu-Trp-OH
- Leucyltryptophan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-2-((S)-2-Amino-4-Methylpentanamido)-3-(1H-Indol-3-Yl)Propanoic Acid
CAS:Formula:C17H23N3O3Purity:95%Color and Shape:SolidMolecular weight:317.3828(S)-2-((S)-2-Amino-4-methylpentanamido)-3-(1H-indol-3-yl)propanoic acid
CAS:(S)-2-((S)-2-Amino-4-methylpentanamido)-3-(1H-indol-3-yl)propanoic acidPurity:97%Molecular weight:317.39g/molH-Leu-Trp-OH
CAS:H-Leu-Trp-OH is a synthetic peptide that is used to lower blood pressure. H-Leu-Trp-OH has been shown to be stereoselective and has antihypertensive activity. It also inhibits the oxidation of amino acids, and its production in the intestine may contribute to lowering blood pressure. This peptide is composed of three amino acids: H-leucine, L-tryptophan, and L-phenylalanine. The diastereomer of this peptide contains two chiral centers at carbons 3 and 4, while the cyclic peptide contains only one chiral center at carbon 3. H-Leu-Trp-OH was synthesized by reacting wheat germ with tripeptides.
Formula:C17H23N3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:317.38 g/molH-Leu-Trp-OH
CAS:LW is an ACE-inhibitory dipeptide found in fermented milk, IC₅₀ 6.6 μM. Substrate for aminopeptidase W, Km 0.57 mM and kcat 6770 min⁻¹.Formula:C17H23N3O3Purity:> 99%Color and Shape:White PowderMolecular weight:317.39



