CAS 5157-15-3
:Tetrahydro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
Description:
Tetrahydro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5(1H,3H)-dione, with CAS number 5157-15-3, is a heterocyclic compound characterized by its complex bicyclic structure, which includes both imidazole and imidazolidine rings. This compound typically exhibits a solid state at room temperature and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of two phenyl groups contributes to its stability and may influence its solubility and reactivity. The imidazole moiety is significant in medicinal chemistry, often serving as a pharmacophore in various drug designs. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic phenyl groups and the nitrogen-containing rings. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a valuable scaffold in the development of new therapeutic agents.
Formula:C16H14N4O2
InChI:InChI=1S/C16H14N4O2/c21-13-17-15(11-7-3-1-4-8-11)16(19-13,20-14(22)18-15)12-9-5-2-6-10-12/h1-10H,(H2,17,19,21)(H2,18,20,22)
InChI key:InChIKey=WUDVGTHXCLJVJN-UHFFFAOYSA-N
SMILES:O=C1NC2(C(NC(=O)N2)(N1)C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 3a,6a-Diphenylperhydroimidazo[4,5-d]imidazole-2,5-dione
- 3a,6a-diphenyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
- 7,8-Diphenylglycoluril
- Diphenylglycoluril
- Glycoluril, 3a,6a-diphenyl-
- Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, tetrahydro-3a,6a-diphenyl-
- NSC 144422
- NSC 87602
- Tetrahydro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3a,6a-Diphenyloctahydroimidazo[4,5-d]imidazole-2,5-dione
CAS:Formula:C16H14N4O2Purity:98%Color and Shape:SolidMolecular weight:294.3080Phenytoin EP Impurity D
CAS:Formula:C16H14N4O2Color and Shape:White To Off-White SolidMolecular weight:294.313a,6a-Diphenyltetra-hydroimidazo[4,5-d]imidazole-2,5(1H, 3H)-dione
CAS:Controlled ProductFormula:C16H14N4O2Color and Shape:NeatMolecular weight:294.31Diphenylglycoluril
CAS:Controlled ProductApplications Diphenylglycoluril is a bicyclic bis-urea derivative. Studies suggest that it has potential anticonvulsant activity.Diphenylglycoluril is also an impurity found in the synthesis of Phenytoin (D491650).
References Khlebnikov, A.I. et al.: Pharm. Chem. J., 36, 240 (2002); Babkibayev, A.A. et al.: Pharm. Chem. J., 8, 15 (1994);Formula:C16H14N4O2Color and Shape:NeatMolecular weight:294.31Diphenylglycoluril
CAS:Diphenylglycoluril is an organic molecule that is a receptor molecule. It binds to silver ions and has been shown to be an effective antimicrobial agent against methicillin-resistant Staphylococcus aureus (MRSA). Diphenylglycoluril also has the ability to inhibit transfer reactions, which are involved in the formation of cavity-causing bacteria.Formula:C16H14N4O2Purity:Min. 97 Area-%Color and Shape:White PowderMolecular weight:294.31 g/mol





