CAS 51572-54-4
:Cyclopentanecarboxylic acid, 1-bromo-, methyl ester
Description:
Cyclopentanecarboxylic acid, 1-bromo-, methyl ester, with the CAS number 51572-54-4, is an organic compound characterized by its cyclopentane ring structure substituted with a carboxylic acid group and a bromine atom at the first position, along with a methyl ester functional group. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the bromine atom can influence its reactivity, making it a potential candidate for nucleophilic substitution reactions. The methyl ester group contributes to its volatility and can affect its boiling and melting points. Cyclopentanecarboxylic acid derivatives are often studied for their applications in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C7H11BrO2
InChI:InChI=1S/C7H11BrO2/c1-10-6(9)7(8)4-2-3-5-7/h2-5H2,1H3
InChI key:YGWINKVROAENAL-UHFFFAOYSA-N
SMILES:COC(=O)C1(CCCC1)Br
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Methyl 1-bromocyclopentanecarboxylate
CAS:Methyl 1-bromocyclopentanecarboxylateFormula:C7H11BrO2Purity:95%Molecular weight:207.07Methyl 1-bromocyclopentanecarboxylate
CAS:Methyl 1-bromocyclopentanecarboxylateFormula:C7H11BrO2Purity:95%Molecular weight:207.07Methyl 1-Bromocyclopentanecarboxylate
CAS:Formula:C7H11BrO2Purity:95%Color and Shape:LiquidMolecular weight:207.067Methyl 1-Bromocyclopentane-1-Carboxylate
CAS:Methyl 1-bromocyclopentane-1-carboxylate is an isomer of the methyl ester of cyclopentanecarboxylic acid. It has been shown to undergo nucleophilic attack by a nucleophile, such as ammonia, methylamine, or water. The reaction mechanism involves a carbonyl group with an adjacent amide that can be protonated to form a carbanion intermediate. This intermediate then reacts with a nucleophile to form the desired product and regenerates the carbonyl group. Methyl 1-bromocyclopentane-1-carboxylate was not able to be crystallized in x-ray diffraction studies due to its high melting point.Formula:C7H11BrO2Purity:Min. 95%Molecular weight:207.06 g/mol




