CAS 51572-88-4
:4-Formyl-2-hydroxybenzoic acid
Description:
4-Formyl-2-hydroxybenzoic acid, also known as salicylaldehyde-4-carboxylic acid, is an organic compound characterized by the presence of both an aldehyde and a carboxylic acid functional group on a benzene ring. Its molecular structure features a hydroxyl group (-OH) and a formyl group (-CHO) at the para and ortho positions, respectively, relative to the carboxylic acid (-COOH) group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to its ability to form hydrogen bonds. It exhibits properties such as acidity, which is attributed to the carboxylic acid group, and reactivity typical of aldehydes, making it useful in various chemical syntheses. Additionally, 4-Formyl-2-hydroxybenzoic acid can participate in reactions such as esterification and condensation, and it may serve as a precursor in the synthesis of more complex organic molecules. Its applications span across fields like pharmaceuticals, agrochemicals, and materials science.
Formula:C8H6O4
InChI:InChI=1S/C8H6O4/c9-4-5-1-2-6(8(11)12)7(10)3-5/h1-4,10H,(H,11,12)
InChI key:InChIKey=JQSSYLDZHAPSJO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=C(C=O)C=C1
Synonyms:- 2-Hydroxyterephthalaldehydic acid
- 4-Formyl-2-hydroxy-benzoic acid
- Benzoic acid, 4-formyl-2-hydroxy-
- Terephthalaldehydic acid, hydroxy-
- 4-Formyl-2-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydroxy-4-formylbenzoic acid
CAS:2-Hydroxy-4-formylbenzoic acidPurity:≥95%Molecular weight:166.13g/mol4-formyl-2-hydroxybenzoic acid
CAS:Controlled ProductFormula:C8H6O4Color and Shape:NeatMolecular weight:166.134-Formyl-2-hydroxybenzoic acid
CAS:4-Formyl-2-hydroxybenzoic acid is a hydroxybenzoic acid that can be synthesized from salicylic acid. It has been used as an antibiotic and has shown to have anti-inflammatory properties. 4-Formyl-2-hydroxybenzoic acid is not fluorescent and does not have any imprinting nature. The molecule can undergo modifications, such as the addition of a formyl group, which increases its antimicrobial activity. The molecule's template molecule is the hydroxybenzoic acid molecule with a hydroxymethyl group on one side and a carboxylic acid on the other side.Formula:C8H6O4Purity:Min. 95%




