CAS 51579-82-9
:Amfenac
Description:
Amfenac is a non-steroidal anti-inflammatory drug (NSAID) that is primarily used for its analgesic and anti-inflammatory properties. It is characterized by its ability to inhibit cyclooxygenase enzymes (COX-1 and COX-2), which play a crucial role in the synthesis of prostaglandins, compounds involved in inflammation and pain signaling. Amfenac is typically administered in the form of its sodium salt, which enhances its solubility and bioavailability. The substance is known for its relatively rapid onset of action and is often utilized in the management of pain associated with conditions such as arthritis and other inflammatory disorders. In terms of its chemical structure, Amfenac features a phenylacetic acid moiety, contributing to its pharmacological activity. While generally well-tolerated, like other NSAIDs, it may have side effects, including gastrointestinal discomfort and potential cardiovascular risks, particularly with long-term use. As with any medication, it is essential to use Amfenac under the guidance of a healthcare professional to ensure safety and efficacy.
Formula:C15H13NO3
InChI:InChI=1S/C15H13NO3/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10/h1-8H,9,16H2,(H,17,18)
InChI key:InChIKey=SOYCMDCMZDHQFP-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(N)C(CC(O)=O)=CC=C1)C2=CC=CC=C2
Synonyms:- (2-Amino-3-benzoylphenyl)essigsaeure
- 2-(2-Amino-3-benzoylphenyl)acetic acid
- 2-Amino-3-benzoylbenzeneacetic acid
- 2-Amino-3-benzoylphenyl)acetic acid
- Amfenac [INN:BAN]
- Amfenacum
- Amfenacum [INN-Latin]
- Benzeneacetic acid, 2-amino-3-benzoyl-
- NSC 309467
- Amfenac
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amfenac
CAS:<p>Amfenac promotes apoptosis in ARPE-19 cell culture.</p>Formula:C15H13NO3Color and Shape:SolidMolecular weight:255.27
