CymitQuimica logo

CAS 51581-50-1

:

1-(2-Chlorophenyl)imidazole

Description:
1-(2-Chlorophenyl)imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the 2-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the second position, influencing the compound's chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic character. It is often studied for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The imidazole moiety is known for its ability to participate in hydrogen bonding and coordination with metal ions, which can enhance its biological efficacy. Additionally, the chlorine substituent can affect the electronic properties of the molecule, potentially altering its interaction with biological targets. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7ClN2
InChI:InChI=1/C9H7ClN2/c10-8-3-1-2-4-9(8)12-6-5-11-7-12/h1-7H
InChI key:ZGGZGKAVJNFVHE-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)Cl)n1ccnc1
Synonyms:
  • 1-(2-chlorophenyl)-1H-imidazole
Found 2 products.