CAS 51581-52-3: 1-(3-Chlorophenyl)-1H-imidazole
Description:1-(3-Chlorophenyl)-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a 3-chlorophenyl group enhances its biological activity and solubility properties. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. It is often studied for its potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development, due to its ability to interact with various biological targets. The imidazole moiety is known for its role in biological systems, including its presence in histidine, an essential amino acid. Additionally, the chlorophenyl substituent can influence the compound's lipophilicity and reactivity, making it a subject of interest in synthetic organic chemistry. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, 1-(3-Chlorophenyl)-1H-imidazole represents a versatile scaffold in chemical research.
Formula:C9H7ClN2
InChI:InChI=1S/C9H7ClN2/c10-8-2-1-3-9(6-8)12-5-4-11-7-12/h1-7H
InChI key:InChIKey=LEKTXVRARNYCNV-UHFFFAOYSA-N
SMILES:ClC1=CC=CC(=C1)N2C=NC=C2
- Synonyms:
- 1-(3-chlorophenyl)-1H-imidazole
- 1-(m-Chlorophenyl)imidazole
- 1H-Imidazole, 1-(3-chlorophenyl)-
- 1H-Imidazole, 1-(3-chlorophenyl)- (9CI)
- Brn 0510023
- Imidazole, 1-(m-chlorophenyl)-
- Nsc 220073
- 1-(3-Chlorophenyl)imidazole
- 5-23-04-00268 (Beilstein Handbook Reference)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-(3-CHLOROPHENYL)IMIDAZOLE REF: IN-DA00DCZICAS: 51581-52-3 | - - - | To inquire | Mon 14 Apr 25 |
 | 1-(3-Chlorophenyl)imidazole REF: 54-OR1020821CAS: 51581-52-3 | - - - | 109.00 €~162.00 € | Tue 15 Apr 25 |
 | 1-(3-Chlorophenyl)imidazole REF: 10-F018426CAS: 51581-52-3 | 98.0% | - - - | Discontinued product |
 | 1-(3-chlorophenyl)imidazole REF: 3D-BCA58152CAS: 51581-52-3 | Min. 95% | - - - | Discontinued product |
1-(3-Chlorophenyl)imidazole
Ref: 10-F018426
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
1-(3-chlorophenyl)imidazole
Ref: 3D-BCA58152
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
