CAS 51584-21-5

2,5-Dichloro-3,4-dinitrothiophene

Description:

2,5-Dichloro-3,4-dinitrothiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features two chlorine atoms and two nitro groups attached to the thiophene ring, contributing to its reactivity and potential applications in various chemical processes. The presence of the chlorine atoms enhances its electrophilic properties, while the nitro groups can participate in further chemical reactions, making it useful in synthetic organic chemistry. Typically, compounds like this may exhibit significant stability under standard conditions but can be sensitive to heat and light. Additionally, due to the presence of halogen and nitro groups, 2,5-Dichloro-3,4-dinitrothiophene may have implications in the field of agrochemicals or as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose environmental and health risks.

Formula: C₄Cl₂N₂O₄S

InChI: InChI=1/C4Cl2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3

SMILES: c1(c(c(Cl)sc1Cl)N(=O)=O)N(=O)=O

2,5-Dichloro-3,4-dinitrothiophene

CAS: 51584-21-5

Formula: C₄Cl₂N₂O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 243.0248

Ref: IN-DA003FX0

2,5-dichloro-3,4-dinitrothiophene

CAS: 51584-21-5

2,5-dichloro-3,4-dinitrothiophene

Purity: ≥95%

Molecular weight: 243.02g/mol

Ref: 54-OR23774

2,5-Dichloro-3,4-dinitrothiophene

CAS: 51584-21-5

Purity: 98%

Molecular weight: 243.0099945

Ref: 10-F620049

2,5-Dichloro-3,4-dinitrothiophene

CAS: 51584-21-5

2,5-Dichloro-3,4-dinitrothiophene is a crystalline solid with a tetragonal crystal system. It has been shown to form with yields of up to 45%, depending on the solvent. The crystal structure has been determined by X-ray crystallography and it was found to be monoclinic with nitro groups interacting in a manner analogous to nitro groups. Nitration of 2,5-dichloro-3,4-dinitrothiophene has been shown to produce 2,5-dichloro-3,4-dinitrobenzene and 2,5-dichloro-3,4-dinitrophenylhydrazine.

Formula: C₄Cl₂N₂O₄S

Purity: Min. 95%

Molecular weight: 243.02 g/mol

Ref: 3D-BCA58421