CAS 515845-97-3
:5-Bromo-2-n-butoxybenzonitrile
Description:
5-Bromo-2-n-butoxybenzonitrile is an organic compound characterized by its bromine and nitrile functional groups, along with a butoxy substituent on the benzene ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The butoxy group, a branched alkyl ether, enhances the compound's solubility in organic solvents and may affect its biological activity. As a nitrile, it features a carbon triple-bonded to a nitrogen atom, contributing to its potential as a building block in organic synthesis and pharmaceuticals. This compound may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, it may possess specific applications in medicinal chemistry, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 5-Bromo-2-n-butoxybenzonitrile is a versatile compound with potential utility in various chemical applications.
Formula:C11H12BrNO
InChI:InChI=1/C11H12BrNO/c1-2-3-6-14-11-5-4-10(12)7-9(11)8-13/h4-5,7H,2-3,6H2,1H3
Synonyms:- Benzonitrile, 5-Bromo-2-Butoxy-
- 5-Bromo-2-Butoxybenzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
