CAS 51586-23-3

1-(4-chlorophenyl)-N-methylethanamine

Description:

1-(4-chlorophenyl)-N-methylethanamine, also known as 4-chloro-N-methyl-β-phenethylamine, is an organic compound characterized by its amine functional group and a chlorinated aromatic ring. It features a 4-chlorophenyl group attached to a nitrogen atom, which is also bonded to a methyl group and an ethylamine chain. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential use in various chemical syntheses and may exhibit biological activity, making it of interest in pharmacological research. The presence of the chlorine atom can influence its reactivity and interaction with biological systems. As with many amines, it may have basic properties, allowing it to form salts with acids. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.

Formula: C₉H₁₂ClN

InChI: InChI=1/C9H12ClN/c1-7(11-2)8-3-5-9(10)6-4-8/h3-7,11H,1-2H3

SMILES: CC(c1ccc(cc1)Cl)NC

Synonyms:

• N-[1-(4-chlorophenyl)ethyl]-N-methylamine

[1-(4-chlorophenyl)ethyl]methylamine hydrochloride

CAS: 51586-23-3

Formula: C₉H₁₃Cl₂N

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 206.11

Ref: 10-F361383