CAS 51591-52-7
:1,2-Propanediol, 2-benzoate
Description:
1,2-Propanediol, 2-benzoate, also known as propylene glycol benzoate, is an ester formed from the reaction of benzoic acid and 1,2-propanediol. It is characterized by its clear, colorless liquid appearance and is soluble in organic solvents while being less soluble in water. This compound exhibits a relatively low volatility and has a moderate boiling point, making it stable under standard conditions. It is primarily used as a plasticizer, solvent, and flavoring agent in various applications, including food, cosmetics, and pharmaceuticals. Additionally, 1,2-Propanediol, 2-benzoate has been noted for its low toxicity profile, which contributes to its safety in consumer products. Its chemical structure allows for interactions with other substances, enhancing its utility in formulations. As with many esters, it may undergo hydrolysis in the presence of water, leading to the release of the parent alcohol and acid. Overall, this compound is valued for its functional properties and versatility in industrial and consumer applications.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-8(7-11)13-10(12)9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3
InChI key:InChIKey=LBPLLQWWWCNJBE-UHFFFAOYSA-N
SMILES:C(OC(CO)C)(=O)C1=CC=CC=C1
Synonyms:- 1-Hydroxyisopropyl benzoate
- 1-Hydroxypropan-2-yl benzoate
- 1-Hydroxy-2-propyl benzoate
- 1-Hydroxyprop-2-yl benzoate
- 1-hydroxypropan-2-yl benzoate
- 1,2-Propanediol, 2-benzoate
- 1-Methyl-2-hydroxyethyl benzoate
- Benzoic acid 1-methyl-2-hydroxyethyl ester
- 2-(Benzoyloxy)-1-propanol
- Einecs 257-304-3
- Pacritinib Impurity 8
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
