CAS 516-15-4: Pregn-4-ene-3,11,20-trione
Description:Pregn-4-ene-3,11,20-trione, commonly known as progesterone, is a steroid hormone that plays a crucial role in the menstrual cycle, pregnancy, and embryogenesis in humans and other species. It is characterized by its structure, which includes a steroid backbone with three ketone groups at positions 3, 11, and 20. This compound is typically a white crystalline solid and is soluble in organic solvents such as ethanol and chloroform but has limited solubility in water. Progesterone is synthesized in the ovaries, placenta, and adrenal glands and is essential for maintaining the early stages of pregnancy by preparing the endometrium for implantation and inhibiting uterine contractions. It also plays a role in regulating various physiological processes, including the menstrual cycle and the development of mammary glands. Due to its biological significance, progesterone is used therapeutically in hormone replacement therapy and in the treatment of various reproductive health issues. Its CAS number, 516-15-4, is a unique identifier that facilitates the identification and study of this important hormone in scientific literature and databases.
Formula:C21H28O3
InChI:InChI=1S/C21H28O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h10,15-17,19H,4-9,11H2,1-3H3/t15-,16+,17-,19+,20-,21+/m0/s1
InChI key:InChIKey=WKAVAGKRWFGIEA-DADBAOPHSA-N
SMILES:O=C1C=C2CCC3C(C(=O)CC4(C)C(C(=O)C)CCC34)C2(C)CC1
- Synonyms:
- 11-Ketoprogesterone
- 11-Oxopregn-4-ene-3,20-dione
- 11-Oxoprogesterone
- 4-Pregnene-3,11,20-trione
- Dg 322A
- Ketogestin
- Ketoprogesterone
- Pregn-4-Ene-3,11,20-Trione
- Stx 124
- U 1258
- See more synonyms
- Δ<sup>4</sup>-Pregnene-3,11,20-trione
