CAS 51605-33-5
:4-(chloromethyl)-5-methyl-1H-imidazole hydrochloride (1:1)
Description:
4-(Chloromethyl)-5-methyl-1H-imidazole hydrochloride is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and pharmaceutical research. The presence of the chloromethyl group at the 4-position and the methyl group at the 5-position of the imidazole ring contributes to its reactivity and potential as a building block in the synthesis of more complex molecules. The compound is often used in medicinal chemistry for the development of biologically active compounds, particularly in the context of drug discovery. Its properties include moderate stability under standard conditions, but it may be sensitive to moisture and light. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Proper storage in a cool, dry place is recommended to maintain its integrity.
Formula:C5H8Cl2N2
InChI:InChI=1/C5H7ClN2.ClH/c1-4-5(2-6)8-3-7-4;/h3H,2H2,1H3,(H,7,8);1H
SMILES:Cc1c(CCl)[nH]cn1.Cl
Synonyms:- 5-(Chloromethyl)-4-methyl-1H-imidazole hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Chloromethyl-4-methylimidazole hcl
CAS:Formula:C5H8Cl2N2Purity:95%Color and Shape:SolidMolecular weight:167.03645-(Chloromethyl)-4-methyl-1H-imidazole hydrochloride
CAS:5-(Chloromethyl)-4-methyl-1H-imidazole hydrochloridePurity:≥95%Color and Shape:SolidMolecular weight:167.04g/mol5-(Chloromethyl)-4-methyl-1H-imidazole hydrochloride
CAS:Isothiourea is an imidazole derivative that acts as a competitive antagonist of histamine H2 receptors. It has been used in the synthesis of cimetidine and other histamine H2 receptor antagonists. Isothiourea inhibits the action of histamine on the H2 receptor by binding to it, thereby preventing its activation. This drug is a synthetic compound that can be made from chloroform and thionyl chloride. It may be synthesized in a two-step process starting with chloromethyl methyl (methylchloro)imidazole, which is reacted with hydrochloric acid to produce 5-(chloromethyl)-4-methyl-1H-imidazole hydrochloride.Formula:C5H8Cl2N2Purity:Min. 95%Molecular weight:167.04 g/mol


