CAS 51607-21-7
:6-deoxy-D-altritol
Description:
6-Deoxy-D-altritol is a sugar alcohol that belongs to the class of polyols, characterized by the absence of a hydroxyl group at the sixth carbon position compared to its parent sugar, D-altritol. Its molecular formula is C6H14O6, and it features a structure that includes multiple hydroxyl (-OH) groups, contributing to its hydrophilic nature. This compound is typically a white, crystalline solid that is soluble in water, making it useful in various applications, including food and pharmaceutical industries as a sweetener or humectant. The absence of the sixth hydroxyl group alters its reactivity and biological properties compared to other sugar alcohols. Additionally, 6-deoxy-D-altritol can participate in various chemical reactions, including oxidation and reduction, and may serve as an intermediate in carbohydrate metabolism. Its CAS number, 51607-21-7, is a unique identifier that facilitates the tracking and regulation of this substance in scientific literature and databases. Overall, 6-deoxy-D-altritol is an interesting compound with potential applications in biochemistry and industry.
Formula:C6H14O5
InChI:InChI=1/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4-,5-,6+/m1/s1
Synonyms:- D-altritol, 6-deoxy-
- 6-Deoxy-D-altritol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Deoxy-D-altritol
CAS:<p>6-Deoxy-D-altritol is a structural analysis of a polysaccharide carbohydrate that is found in the cell walls of asteroides. It has been shown to contain mannose, d-arabinose, and d-glucose residues. 6-Deoxy-D-altritol also contains galactosyl and phosphate groups. The backbone of 6-Deoxy-D-altritol is made up of phosphodiester bonds with a d-galactose skeleton. This molecule can be used for the identification and characterization of bacteria species such as Mycobacterium tuberculosis and Mycobacterium avium complex.</p>Formula:C6H14O5Purity:Min. 95%Molecular weight:166.17 g/mol
