CAS 51607-21-7

6-deoxy-D-altritol

Description:

6-Deoxy-D-altritol is a sugar alcohol that belongs to the class of polyols, characterized by the absence of a hydroxyl group at the sixth carbon position compared to its parent sugar, D-altritol. Its molecular formula is C6H14O6, and it features a structure that includes multiple hydroxyl (-OH) groups, contributing to its hydrophilic nature. This compound is typically a white, crystalline solid that is soluble in water, making it useful in various applications, including food and pharmaceutical industries as a sweetener or humectant. The absence of the sixth hydroxyl group alters its reactivity and biological properties compared to other sugar alcohols. Additionally, 6-deoxy-D-altritol can participate in various chemical reactions, including oxidation and reduction, and may serve as an intermediate in carbohydrate metabolism. Its CAS number, 51607-21-7, is a unique identifier that facilitates the tracking and regulation of this substance in scientific literature and databases. Overall, 6-deoxy-D-altritol is an interesting compound with potential applications in biochemistry and industry.

Formula: C₆H₁₄O₅

InChI: InChI=1/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4-,5-,6+/m1/s1

Synonyms:

• D-altritol, 6-deoxy-
• 6-Deoxy-D-altritol

6-Deoxy-D-altritol

CAS: 51607-21-7

6-Deoxy-D-altritol is a structural analysis of a polysaccharide carbohydrate that is found in the cell walls of asteroides. It has been shown to contain mannose, d-arabinose, and d-glucose residues. 6-Deoxy-D-altritol also contains galactosyl and phosphate groups. The backbone of 6-Deoxy-D-altritol is made up of phosphodiester bonds with a d-galactose skeleton. This molecule can be used for the identification and characterization of bacteria species such as Mycobacterium tuberculosis and Mycobacterium avium complex.

Formula: C₆H₁₄O₅

Purity: Min. 95%

Molecular weight: 166.17 g/mol

Ref: 3D-MD163422