CAS 51618-30-5

6-Bromo-2-mercaptobenzothiazole

Description:

6-Bromo-2-mercaptobenzothiazole is an organic compound characterized by its heterocyclic structure, which includes a benzothiazole moiety with a bromine atom and a thiol (-SH) group. This compound typically appears as a solid and is known for its role as a rubber accelerator and a corrosion inhibitor. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many benzothiazole derivatives. The presence of the bromine atom enhances its reactivity, making it useful in various chemical syntheses and applications. Additionally, the thiol group contributes to its ability to form metal complexes, which is beneficial in applications such as metal ion detection and stabilization. Safety considerations include potential skin and eye irritation, and appropriate handling measures should be taken to minimize exposure. Overall, 6-Bromo-2-mercaptobenzothiazole is valued in industrial applications for its chemical properties and functional versatility.

Formula: C₇H₄BrNS₂

InChI: InChI=1/C7H4BrNS2/c8-4-1-2-5-6(3-4)11-7(10)9-5/h1-3H,(H,9,10)

SMILES: c1cc2c(cc1Br)sc(n2)S

Synonyms:

• 2-Benzothiazolethiol, 6-Bromo-
• 6-Bromo-1,3-benzothiazole-2-thiol
• 6-bromo-1,3-benzothiazole-2(3H)-thione

6-Bromo-2-mercaptobenzothiazole

CAS: 51618-30-5

Formula: C₇H₄BrNS₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.1474

Ref: IN-DA006URM

6-Bromobenzo[d]thiazole-2(3H)-thione

CAS: 51618-30-5

6-Bromobenzo[d]thiazole-2(3H)-thione

Purity: 97%

Molecular weight: 246.15g/mol

Ref: 54-OR89709

6-Bromobenzo[d]thiazole-2(3H)-thione

CAS: 51618-30-5

Formula: C₇H₄BrNS₂

Purity: 98%

Molecular weight: 246.14

Ref: 10-F227711