CAS 5162-48-1
:2,2,4-Trimethyl-3-pentanol
Description:
2,2,4-Trimethyl-3-pentanol is an organic compound classified as a tertiary alcohol. Its molecular formula is C8H18O, and it features a branched structure that contributes to its unique properties. This compound is characterized by the presence of a hydroxyl (-OH) functional group, which imparts typical alcohol characteristics such as solubility in water and the ability to participate in hydrogen bonding. The branched nature of its carbon chain affects its boiling point and volatility, making it less volatile than straight-chain alcohols of similar molecular weight. 2,2,4-Trimethyl-3-pentanol is often used as a solvent and in various chemical syntheses due to its relatively low toxicity and favorable handling properties. Additionally, it can serve as an intermediate in the production of other chemical compounds. Its physical properties, such as density and viscosity, are influenced by its molecular structure, and it is generally stable under standard conditions. However, like many organic solvents, it should be handled with care to avoid inhalation or skin contact.
Formula:C8H18O
InChI:InChI=1S/C8H18O/c1-6(2)7(9)8(3,4)5/h6-7,9H,1-5H3
InChI key:InChIKey=AXINNNJHLJWMTC-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(C(C)C)O
Synonyms:- (3S)-2,2,4-trimethylpentan-3-ol
- (R,S)-2,2,4-Trimethylpentan-3-ol
- 2,2,4-Trimethyl-3-pentanol
- 2,2,4-Trimethyl-3-pentyl alcohol
- 2,4,4-Trimethyl-3-pentanol
- 3-Pentanol, 2,2,4-trimethyl-
- 3-amino-4-(tert-butylamino)-2H-chromen-2-one
- Isopropyl-tert-butylcarbinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.