CAS 5162-82-3
:3-Chloro-4-methylbenzoic acid
Description:
3-Chloro-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a methyl group on a benzoic acid framework. The chlorine atom is located at the meta position (3-position) relative to the carboxylic acid group, while the methyl group is situated at the para position (4-position). This compound typically appears as a white to off-white crystalline solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It has a melting point that varies depending on purity and specific conditions. The presence of both the chlorine and methyl substituents influences its chemical reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 3-chloro-4-methylbenzoic acid can participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the chlorine atom, which can affect the reactivity of the aromatic ring. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H7ClO2
InChI:InChI=1/C8H7ClO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11)/p-1
InChI key:InChIKey=SDKUOEOJAXGCLU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Cl)=C(C)C=C1
Synonyms:- 3-Chloro-4-Methylbenzoate
- 3-Chloro-4-Toluic Acid
- 3-Chloro-P-Toluic
- 3-Chloro-P-Toluic Acid
- 3-Chloro-P-Toluicaci
- 4-Methyl -3-Chlorobenzoic acid
- Benzoic acid, 3-chloro-4-methyl-
- Rarechem Al Bo 1236
- p-Toluic acid, 3-chloro-
- 3-Chloro-4-methylbenzoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Chloro-4-methylbenzoic Acid
CAS:Formula:C8H7ClO2Purity:>98.0%(GC)(T)Color and Shape:White to Light red to Green powder to crystalMolecular weight:170.593-Chloro-4-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:95%Color and Shape:SolidMolecular weight:170.59303-Chloro-4-methylbenzoic acid
CAS:3-Chloro-4-methylbenzoic acidFormula:C8H7ClO2Purity:97%Color and Shape: pale yellow solidMolecular weight:170.59g/mol3-Chloro-4-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:95%Color and Shape:SolidMolecular weight:170.593-Chloro-4-methylbenzoic acid
CAS:Controlled ProductApplications 3-Chloro-4-methylbenzoic acid
Formula:C8H7ClO2Color and Shape:NeatMolecular weight:170.593-Chloro-4-toluic acid
CAS:3-Chloro-4-toluic acid is a quinone, which is derived from 3,4-dichlorotoluene. It has been shown to bind to nuclear receptors and act as a retinoic acid linker. This compound is also used in the synthesis of organic compounds by desorption in an acidic environment, followed by methyl esterification with an alcohol. 3-Chloro-4-toluic acid can be converted into zirconium chloride or hydrotalcite through chlorination or hydrochlorination. The resulting product can be used for dispersive solid-phase extraction methods.
Formula:C8H7ClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:170.59 g/mol





