CAS 5162-90-3
:2-Amino-3-(1,2-dihydro-2-oxoquinoline-4-yl)propanoic acid
Description:
2-Amino-3-(1,2-dihydro-2-oxoquinoline-4-yl)propanoic acid, with the CAS number 5162-90-3, is an organic compound that features both amino and carboxylic acid functional groups, making it an amino acid derivative. This compound is characterized by its quinoline structure, which contributes to its potential biological activity. The presence of the dihydro-2-oxoquinoline moiety suggests that it may exhibit unique chemical properties, such as the ability to participate in hydrogen bonding and π-π stacking interactions. The amino group allows for potential interactions with other biomolecules, while the carboxylic acid group can engage in acid-base chemistry. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could influence its pharmacological properties. Additionally, its solubility and stability in various solvents can vary, impacting its applications in research and industry. Overall, 2-Amino-3-(1,2-dihydro-2-oxoquinoline-4-yl)propanoic acid represents a fascinating subject for further study in the context of organic and medicinal chemistry.
Formula:C12H12N2O3
InChI:InChI:1S/C12H12N2O3/c13-9(12(16)17)5-7-6-11(15)14-10-4-2-1-3-8(7)10/h1-4,6,9H,5,13H2,(H,14,15)(H,16,17)
Synonyms:- 1,2-Dihydro-2-oxo-4-quinolinealanine
- 2-Amino-3-(1,2-dihydro-2-oxo-4-quinolineyl)propionic acid
- 2-(4-bromophenyl)-2-oxoethyl (2E,4E)-hexa-2,4-dienoate
- 2-Amino-3-(1,2-dihydro-2-oxoquinoline-4-yl)propoicacid
- 2-Amino-3-[2(1H)-quinolinon-4-yl]-Propinonic acid
- OQA
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid
CAS:Formula:C12H12N2O3Purity:95%Color and Shape:SolidMolecular weight:232.23532-Amino-3-(1,2-dihydro-2-oxoquinolin-4-yl)propanoic acid
CAS:<p>2-Amino-3-(1,2-dihydro-2-oxoquinolin-4-yl)propanoic acid</p>Formula:C12H12N2O3Purity:≥95%Color and Shape: white to faint orange crystalline powderMolecular weight:232.24g/mol2-Amino-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid
CAS:Color and Shape:SolidMolecular weight:232.238998413085942-Amino-3-(1.2-dihydro-2-oxoquinoline-4-yl)propanoic acid
CAS:Please enquire for more information about 2-Amino-3-(1.2-dihydro-2-oxoquinoline-4-yl)propanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H12N2O3Purity:Min. 95%Molecular weight:232.24 g/mol




