CAS 51627-47-5

2-morpholino-3-pyridinamine

Description:

2-Morpholino-3-pyridinamine, with the CAS number 51627-47-5, is an organic compound characterized by its pyridine and morpholine functional groups. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the morpholino group contributes to its basicity and solubility in polar solvents, while the pyridinamine structure can participate in hydrogen bonding and other interactions, making it a versatile building block in organic synthesis. Its molecular structure allows for various substitutions, which can influence its biological activity and reactivity. Additionally, 2-morpholino-3-pyridinamine may exhibit properties such as moderate stability under standard conditions, but it should be handled with care due to potential reactivity with strong acids or bases. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines to ensure safe laboratory practices.

Formula: C₉H₁₃N₃O

InChI: InChI=1/C9H13N3O/c10-8-2-1-3-11-9(8)12-4-6-13-7-5-12/h1-3H,4-7,10H2/p+1

Synonyms:

• 2-Morpholin-4-Ylpyridin-3-Amine
• 3-Amino-2-Morpholin-4-Ylpyridinium

2-MORPHOLINO-3-PYRIDINAMINE

CAS: 51627-47-5

Formula: C₉H₁₃N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.2190

Ref: IN-DA00DCU3

3-Amino-2-morpholin-4-ylpyridine

CAS: 51627-47-5

3-Amino-2-morpholin-4-ylpyridine

Formula: C₉H₁₃N₃O

Purity: ≥95%

Color and Shape: pale purple to purple solid

Molecular weight: 179.22g/mol

Ref: 54-OR23393

2-Morpholinopyridin-3-amine

CAS: 51627-47-5

Formula: C₉H₁₃N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.223

Ref: 10-F318193