CAS 51640-52-9

2-Aminothiazole-5-carbonitrile

Description:

2-Aminothiazole-5-carbonitrile is a heterocyclic organic compound characterized by the presence of both an amino group and a carbonitrile group attached to a thiazole ring. The thiazole moiety consists of a five-membered ring containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. This compound typically appears as a solid and is known for its potential biological activities, making it of interest in medicinal chemistry and drug development. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the carbonitrile group can engage in various chemical reactions, including nucleophilic additions and cycloadditions. The presence of these functional groups allows for diverse reactivity, making 2-Aminothiazole-5-carbonitrile a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, its structural features may influence its interaction with biological targets, potentially leading to applications in treating various diseases. Overall, this compound exemplifies the significance of heterocycles in organic chemistry and their role in developing new therapeutic agents.

Formula: C₄H₃N₃S

InChI: InChI=1/C4H3N3S/c5-1-3-2-7-4(6)8-3/h2H,(H2,6,7)

SMILES: C(#N)c1c[nH]c(=N)s1

Synonyms:

• 2-Amino-1,3-thiazole-5-carbonitrile
• 5-Thiazolecarbonitrile, 2-Amino-

2-Amino-5-cyanothiazole

CAS: 51640-52-9

Formula: C₄H₃N₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 125.1517

Ref: IN-DA00DABT

2-Amino-1,3-thiazole-5-carbonitrile

CAS: 51640-52-9

2-Amino-1,3-thiazole-5-carbonitrile

Formula: C₄H₃N₃S

Purity: 97%

Color and Shape: dark brown solid

Molecular weight: 125.15g/mol

Ref: 54-OR3230

2-Aminothiazole-5-carbonitrile

CAS: 51640-52-9

Formula: C₄H₃N₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 125.15

Ref: 10-F078801