CymitQuimica logo

CAS 51642-03-6

:

3-Thiophenamine,tetrahydro-, 1,1-dioxide, hydrochloride (1:1)

Description:
3-Thiophenamine, tetrahydro-, 1,1-dioxide, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a thiophene ring and a tetrahydro-1,1-dioxide moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. It is often used in pharmaceutical applications, particularly in the synthesis of various bioactive molecules. The presence of the thiophene ring contributes to its potential biological activity, as thiophene derivatives are known for their diverse pharmacological properties. The hydrochloride form enhances its stability and solubility, making it suitable for various formulations. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of appropriate personal protective equipment, as it may pose health risks if ingested or inhaled. Overall, 3-Thiophenamine, tetrahydro-, 1,1-dioxide, hydrochloride is a compound of interest in medicinal chemistry and related fields.
Formula:C4H9NO2SClH
InChI:InChI=1S/C4H9NO2S.ClH/c5-4-1-2-8(6,7)3-4;/h4H,1-3,5H2;1H
InChI key:MGZQMSFXPSKBDY-UHFFFAOYSA-N
SMILES:C1CS(=O)(=O)CC1N.Cl
Synonyms:
  • 3-Thiophenamine,tetrahydro-, 1,1-dioxide, hydrochloride (9CI)
  • 3-Aminosulfolane hydrochloride
  • Tetrahydro-3-thiophenamine 1,1-dioxide hydrochloride
Found 4 products.