CAS 51642-81-0
:2,3,4,6-tetra-O-acetylhexopyranosylamine
Description:
2,3,4,6-Tetra-O-acetylhexopyranosylamine is a chemical compound that belongs to the class of glycosylamines, which are derivatives of sugars where an amino group replaces a hydroxyl group. This compound features a hexopyranose structure, specifically a pyranose ring, which is a six-membered ring containing five carbon atoms and one oxygen atom. The "tetra-O-acetyl" designation indicates that four hydroxyl groups on the sugar are acetylated, enhancing the compound's stability and solubility in organic solvents. The acetyl groups also influence the compound's reactivity and can facilitate various chemical transformations. This compound is typically used in carbohydrate chemistry and biochemistry for synthesizing more complex molecules, including glycosides and other derivatives. Its properties, such as solubility, melting point, and reactivity, are influenced by the acetyl groups and the overall structure of the hexopyranosylamine. As with many glycosylamines, it may exhibit biological activity, making it of interest in medicinal chemistry and research applications.
Formula:C14H21NO9
InChI:InChI=1/C14H21NO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5,15H2,1-4H3
SMILES:CC(=O)OCC1C(C(C(C(N)O1)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- 2,3,4,6-Tetra-O-Acetyl-Beta-D-Glucopyranosylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3,4,6-Tetra-o-acetyl-β-d-glucopyranosyl amine
CAS:Formula:C14H21NO9Purity:97%Color and Shape:SolidMolecular weight:347.3178(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-aminotetrahydro-2H-pyran-3,4,5-triyl triacetate
CAS:(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-aminotetrahydro-2H-pyran-3,4,5-triyl triacetatePurity:97% (approx. 90% β-D-)Molecular weight:347.32g/mol2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl amine
CAS:<p>2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl amine is a useful organic compound for research related to life sciences.</p>Formula:C14H21NO9Color and Shape:SolidMolecular weight:347.322,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl amine
CAS:<p>2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl amine is an artificial carbohydrate with a fluorinated sugar. It is synthesized by reacting 2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl chloride with ammonia and methyl iodide. The compound can be used to modify the sugar residues of glycosides or polysaccharides. It has been shown to have high purity and can be used in the synthesis of complex carbohydrates.</p>Formula:C14H21NO9Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:347.32 g/mol




