CAS 51642-81-0

2,3,4,6-tetra-O-acetylhexopyranosylamine

Description:

2,3,4,6-Tetra-O-acetylhexopyranosylamine is a chemical compound that belongs to the class of glycosylamines, which are derivatives of sugars where an amino group replaces a hydroxyl group. This compound features a hexopyranose structure, specifically a pyranose ring, which is a six-membered ring containing five carbon atoms and one oxygen atom. The "tetra-O-acetyl" designation indicates that four hydroxyl groups on the sugar are acetylated, enhancing the compound's stability and solubility in organic solvents. The acetyl groups also influence the compound's reactivity and can facilitate various chemical transformations. This compound is typically used in carbohydrate chemistry and biochemistry for synthesizing more complex molecules, including glycosides and other derivatives. Its properties, such as solubility, melting point, and reactivity, are influenced by the acetyl groups and the overall structure of the hexopyranosylamine. As with many glycosylamines, it may exhibit biological activity, making it of interest in medicinal chemistry and research applications.

Formula: C₁₄H₂₁NO₉

InChI: InChI=1/C14H21NO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5,15H2,1-4H3

SMILES: CC(=O)OCC1C(C(C(C(N)O1)OC(=O)C)OC(=O)C)OC(=O)C

Synonyms:

• 2,3,4,6-Tetra-O-Acetyl-Beta-D-Glucopyranosylamine

2,3,4,6-Tetra-o-acetyl-β-d-glucopyranosyl amine

CAS: 51642-81-0

Formula: C₁₄H₂₁NO₉

Purity: 97%

Color and Shape: Solid

Molecular weight: 347.3178

Ref: IN-DA00D9U6

(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-aminotetrahydro-2H-pyran-3,4,5-triyl triacetate

CAS: 51642-81-0

(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-aminotetrahydro-2H-pyran-3,4,5-triyl triacetate

Purity: 97% （approx. 90% β-D-）

Molecular weight: 347.32g/mol

Ref: 54-OR1065705

2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl amine

CAS: 51642-81-0

2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl amine is a useful organic compound for research related to life sciences.

Formula: C₁₄H₂₁NO₉

Color and Shape: Solid

Molecular weight: 347.32

Ref: TM-TNU0856

2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl amine

CAS: 51642-81-0

2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl amine is an artificial carbohydrate with a fluorinated sugar. It is synthesized by reacting 2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl chloride with ammonia and methyl iodide. The compound can be used to modify the sugar residues of glycosides or polysaccharides. It has been shown to have high purity and can be used in the synthesis of complex carbohydrates.

Formula: C₁₄H₂₁NO₉

Purity: Min. 98 Area-%

Color and Shape: White Powder

Molecular weight: 347.32 g/mol

Ref: 3D-MT06149