
CAS 51646-17-4
:5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2(1H)-thione
Description:
5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2(1H)-thione is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a thione functional group, which is a sulfur-containing analogue of a ketone, contributing to its reactivity and potential biological activity. The presence of two methyl groups at the 5 and 7 positions of the triazole ring enhances its lipophilicity and may influence its interaction with biological targets. The compound is typically synthesized through multi-step organic reactions involving the appropriate precursors. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 51646-17-4, allows for easy identification in chemical databases. As with many heterocycles, its properties, such as solubility, stability, and reactivity, can vary significantly based on the specific conditions and substituents present. Overall, 5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2(1H)-thione represents a class of compounds with potential applications in drug discovery and development.
Formula:C7H8N4S
InChI:InChI=1/C7H8N4S/c1-4-3-5(2)11-6(8-4)9-7(12)10-11/h3H,1-2H3,(H,10,12)
SMILES:Cc1cc(C)n2c(n1)nc(=S)[nH]2
Synonyms:- [1,2,4]Triazolo[1,5-A]Pyrimidine-2-Thiol, 5,7-Dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-ylhydrosulfide
CAS:Formula:C7H8N4SPurity:95%Color and Shape:SolidMolecular weight:180.23025,7-Dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-thiol
CAS:5,7-Dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-thiolPurity:95%Molecular weight:180.23g/mol5,7-Dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-thiol
CAS:Formula:C7H8N4SPurity:95.0%Color and Shape:SolidMolecular weight:180.235,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-ylhydrosulfide
CAS:5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-ylhydrosulfide is a compound that is used in the synthesis of fonamide. It is a sugar with nitrification and nitrogen metabolism activity. 5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-ylhydrosulfide can be converted to ammonium hydroxide by reaction with hydroxide or carbon disulfide. The resulting product can be further converted to amides by an amine or ethanol. The structure of this compound is similar to that of fonamide and may have antiinflammatory properties.Formula:C7H8N4SPurity:Min. 95%Molecular weight:180.23 g/molKKJ00626
CAS:KKJ00626, an inhibitor of HBV virus, inhibits HBV replication in transfected Huh7 cells.Formula:C7H8N4SPurity:98%Color and Shape:SolidMolecular weight:180.23




