CAS 51647-90-6

5,7-Dihydroxyimidazo[1,2-a]pyrimidine

Description:

5,7-Dihydroxyimidazo[1,2-a]pyrimidine is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, which contain hydroxyl groups at the 5 and 7 positions. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. It may exhibit properties such as antioxidant activity or serve as a scaffold for drug development. The compound's reactivity can be influenced by the functional groups present, allowing for various chemical modifications. Its CAS number, 51647-90-6, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and applications in scientific literature. Overall, 5,7-Dihydroxyimidazo[1,2-a]pyrimidine represents a significant compound for research in both organic chemistry and biochemistry.

Formula: C₆H₅N₃O₂

InChI: InChI=1/C6H5N3O2/c10-4-3-5(11)9-2-1-7-6(9)8-4/h1-3,11H,(H,7,8,10)

SMILES: c1cn2c(cc(=O)[nH]c2n1)O

Synonyms:

• 5-Hydroxyimidazo[1,2-a]pyrimidin-7(8H)-one
• Imidazo[1,2-a]pyrimidin-7(8H)-one, 5-hydroxy-
• Imidazo[1,2-A]Pyrimidine-5,7-Diol

Imidazo[1,2-a]pyrimidine-5,7-diol

CAS: 51647-90-6

Formula: C₆H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 151.1228

Ref: IN-DA006UFG

5,7-Dihydroxyimidazo[1,2-a]pyrimidine

CAS: 51647-90-6

5,7-Dihydroxyimidazo[1,2-a]pyrimidine

Purity: 97%

Molecular weight: 151.12g/mol

Ref: 54-OR905656

5,7-Dihydroxyimidazo[1,2-a]pyrimidine

Controlled Product

CAS: 51647-90-6

Applications 5,7-Dihydroxyimidazo[1,2-a]pyrimidine (cas# 51647-90-6) is a compound useful in organic synthesis.

Formula: C₆H₅N₃O₂

Color and Shape: Neat

Molecular weight: 151.12

Ref: TR-D452820

5,7-Dihydroxyimidazo[1,2-a]pyrimidine

CAS: 51647-90-6

Formula: C₆H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 151.125

Ref: 10-F079963