CAS 516480-79-8

2-[4-(4-chlorophenoxy)phenyl]-1H-benzimidazole-6-carboxamide

Description:

2-[4-(4-chlorophenoxy)phenyl]-1H-benzimidazole-6-carboxamide, with the CAS number 516480-79-8, is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a carboxamide group and a chlorophenoxyphenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the chlorophenyl group may enhance its lipophilicity, influencing its interaction with biological targets. Additionally, the benzimidazole scaffold is known for its diverse biological activities, including antimicrobial and anticancer properties. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would depend on its purity and the conditions under which it is studied. Overall, this compound represents a class of benzimidazole derivatives that may have significant implications in medicinal chemistry and drug development.

Formula: C₂₀H₁₄ClN₃O₂

InChI: InChI=1/C20H14ClN3O2/c21-14-4-8-16(9-5-14)26-15-6-1-12(2-7-15)20-23-17-10-3-13(19(22)25)11-18(17)24-20/h1-11H,(H2,22,25)(H,23,24)

SMILES: c1cc(ccc1c1[nH]c2ccc(cc2n1)C(=N)O)Oc1ccc(cc1)Cl

Synonyms:

• 1H-benzimidazole-5-carboxamide, 2-[4-(4-chlorophenoxy)phenyl]-
• 2-(4-(4-chlorophenoxy)phenyl)-1H-benzimidazole-5-carboxylic acid amide
• 2-[4-(4-chlorophenoxy)phenyl]-1H-benzimidazole-5-carboxamide

Chk2 Inhibitor II hydrate

CAS: 516480-79-8

Formula: C₂₀H₁₄ClN₃O₂·xH₂O

Molecular weight: 363.80 (anhydrous)

Ref: 7W-GL3909

BML-277

CAS: 516480-79-8

BML-277

Purity: ≥95%

Molecular weight: 363.8g/mol

Ref: 54-BUP10648

BML-277

CAS: 516480-79-8

BML-277 (C 3742) is a selective checkpoint kinase 2 (Chk2) inhibitor.

Formula: C₂₀H₁₄ClN₃O₂

Purity: 98.03% - ≥95%

Color and Shape: Tan Solid

Molecular weight: 363.8

Ref: TM-T2033