CAS 516480-80-1

2-[4-(4-Chlorophenoxy)phenyl]-1H-benzimidazole-6-carboxylic acid

Description:

2-[4-(4-Chlorophenoxy)phenyl]-1H-benzimidazole-6-carboxylic acid, with the CAS number 516480-80-1, is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a carboxylic acid group and a chlorophenoxyphenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the chlorophenyl group may influence its biological interactions, potentially enhancing its efficacy or selectivity in various applications. Additionally, the carboxylic acid functionality can participate in hydrogen bonding and ionic interactions, which may affect its pharmacokinetics and pharmacodynamics. The compound's stability, reactivity, and interaction with biological targets are influenced by its molecular structure, making it a subject of interest in medicinal chemistry and drug development. Overall, this compound represents a class of benzimidazole derivatives that may have therapeutic potential, warranting further investigation into its biological properties and mechanisms of action.

Formula: C₂₀H₁₃ClN₂O₃

InChI: InChI=1S/C20H13ClN2O3/c21-14-4-8-16(9-5-14)26-15-6-1-12(2-7-15)19-22-17-10-3-13(20(24)25)11-18(17)23-19/h1-11H,(H,22,23)(H,24,25)

InChI key: InChIKey=IYDLNJYJAXUZOJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(N=C(N2)C3=CC=C(OC4=CC=C(Cl)C=C4)C=C3)=CC1

Synonyms:

• 1H-Benzimidazole-5-carboxylic acid, 2-[4-(4-chlorophenoxy)phenyl]-
• 2-[4-(4-Chlorophenoxy)phenyl]-1H-benzimidazole-6-carboxylic acid
• 1H-Benzimidazole-6-carboxylic acid, 2-[4-(4-chlorophenoxy)phenyl]-
• 2-[4-(4-Chlorophenoxy)phenyl]-1H-benzimidazole-5-carboxylic acid

BML277 Acid

CAS: 516480-80-1

BML277 Acid is a metabolite of BML277 which is a selective checkpoint kinase 2 inhibitor.

Formula: C₂₀H₁₃ClN₂O₃

Color and Shape: Solid

Molecular weight: 364.78

Ref: TM-T69163