CAS 516510-78-4

1-Bromo-4-(trans-4-n-butylcyclohexyl)benzene

Description:

1-Bromo-4-(trans-4-n-butylcyclohexyl)benzene is an organic compound characterized by the presence of a bromine atom attached to a benzene ring, which is further substituted with a trans-n-butylcyclohexyl group. This compound features a cyclohexane ring that is substituted at one position with a butyl group, and the trans configuration indicates that the substituents are positioned on opposite sides of the cyclohexane ring, influencing its steric and electronic properties. The presence of the bromine atom contributes to the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The molecular structure suggests that it may exhibit hydrophobic characteristics due to the long hydrocarbon chain, which can affect its solubility in different solvents. Additionally, the compound may have applications in materials science, particularly in the development of liquid crystals or as an intermediate in organic synthesis. Its unique structural features can also influence its physical properties, such as melting and boiling points, density, and refractive index.

Formula: C₁₆H₂₃Br

InChI: InChI=1/C16H23Br/c1-2-3-4-13-5-7-14(8-6-13)15-9-11-16(17)12-10-15/h9-14H,2-8H2,1H3/t13-,14-

SMILES: CCCC[C@H]1CC[C@@H](CC1)c1ccc(cc1)Br

Synonyms:

• 4-Trans(4-N-Butyl Cyclohexyl) Bromobenzene
• 1-Bromo-4-(Trans-4-Butylcyclohexyl)Benzene

1-Bromo-4-(trans-4-butylcyclohexyl)benzene

CAS: 516510-78-4

Formula: C₁₆H₂₃Br

Color and Shape: Solid

Molecular weight: 295.2578

Ref: IN-DA003E4N