CAS 51656-68-9
:3-(2,6-dichlorophenyl)propanoic acid
Description:
3-(2,6-Dichlorophenyl)propanoic acid, with the CAS number 51656-68-9, is an organic compound characterized by its propanoic acid backbone substituted with a 2,6-dichlorophenyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals. The presence of the dichlorophenyl moiety contributes to its hydrophobic characteristics, influencing its solubility and reactivity. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the introduction of the dichlorophenyl group onto the propanoic acid framework through electrophilic aromatic substitution or similar methodologies. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C9H8Cl2O2
InChI:InChI=1/C9H8Cl2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-3H,4-5H2,(H,12,13)
SMILES:c1cc(c(CCC(=O)O)c(c1)Cl)Cl
Synonyms:- Benzenepropanoic acid, 2,6-dichloro-
- 3-(2,6-Dichlorophenyl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(2,6-Dichlorophenyl)propionic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H8Cl2O2Purity:96%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:219.063-(2,6-Dichlorophenyl)propionic acid
CAS:Formula:C9H8Cl2O2Purity:97%Color and Shape:SolidMolecular weight:219.06463-(2,6-Dichlorophenyl)propionic acid
CAS:3-(2,6-Dichlorophenyl)propionic acidPurity:98%Molecular weight:219.06462g/mol3-(2,6-Dichlorophenyl)propionic acid
CAS:Formula:C9H8Cl2O2Purity:97%Color and Shape:SolidMolecular weight:219.06



