CAS 51659-21-3
:phenyl(3-phenylaziridin-2-yl)methanone
Description:
Phenyl(3-phenylaziridin-2-yl)methanone, identified by its CAS number 51659-21-3, is a chemical compound characterized by its unique aziridine structure, which is a three-membered cyclic amine. This compound features a phenyl group attached to a methanone functional group, contributing to its reactivity and potential applications in organic synthesis. The aziridine ring is known for its strain and reactivity, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of multiple phenyl groups enhances its stability and may influence its electronic properties, potentially affecting its interactions in biological systems. Additionally, the compound may exhibit interesting optical properties due to the conjugation between the phenyl groups and the aziridine moiety. Its synthesis and characterization are of interest in the field of medicinal chemistry, where such compounds can serve as scaffolds for drug development. Overall, phenyl(3-phenylaziridin-2-yl)methanone represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C15H13NO
InChI:InChI=1/C15H13NO/c17-15(12-9-5-2-6-10-12)14-13(16-14)11-7-3-1-4-8-11/h1-10,13-14,16H
SMILES:c1ccc(cc1)C1C(C(=O)c2ccccc2)N1
Synonyms:- Methanone, phenyl(3-phenyl-2-aziridinyl)-
- Phenyl(3-phenylaziridin-2-yl)methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-benzoyl-3-phenylaziridine
CAS:Controlled ProductFormula:C15H13NOColor and Shape:NeatMolecular weight:223.272-Benzoyl-3-phenylaziridine
CAS:<p>2-Benzoyl-3-phenylaziridine is a heterocyclic compound that is obtained by the condensation of benzoyl chloride and phenylamine. It is used in the synthesis of azomethine dyes, which are mainly used as textile dyes. The ammonium salt of 2-benzoyl-3-phenylaziridine can be obtained on refluxing the hydrate with thiocyanate and acetonitrile. This transformation has been shown to be dependent on pH with an optimum at pH 8.5.</p>Formula:C15H13NOPurity:Min. 95%Molecular weight:223.27 g/mol

