CAS 51660-15-2
:4-chloro-2-(methylsulfanyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine
Description:
4-Chloro-2-(methylsulfanyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrimidine and a cyclopentane moiety. The presence of a chlorine atom and a methylthio group (methylsulfanyl) contributes to its reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents, and its chemical properties can be influenced by the electron-withdrawing nature of the chlorine substituent and the electron-donating characteristics of the methylthio group. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the functional groups present. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as similar compounds have been explored for their biological activities. However, specific biological activities and toxicity profiles would require further investigation through experimental studies.
Formula:C8H9ClN2S
InChI:InChI=1/C8H9ClN2S/c1-12-8-10-6-4-2-3-5(6)7(9)11-8/h2-4H2,1H3
SMILES:CSc1nc2CCCc2c(Cl)n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Chloro-2-(methylthio)-6,7-dihydro-5H-cyclopenta[d]pyrimidine
CAS:Formula:C8H9ClN2SMolecular weight:200.68854-Chloro-6,7-dihydro-2-(methylthio)-5H-cyclopenta[d]pyrimidine
CAS:<p>4-Chloro-6,7-dihydro-2-(methylthio)-5H-cyclopenta[d]pyrimidine</p>Molecular weight:200.69g/mol


