CAS 51660-65-2

4-iodo-1,3,5-trimethyl-1H-pyrazole

Description:

4-Iodo-1,3,5-trimethyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of three methyl groups at the 1, 3, and 5 positions contributes to its hydrophobic character and influences its reactivity and solubility. The iodine substituent at the 4-position enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its unique structure allows it to participate in diverse applications, particularly in the fields of pharmaceuticals and agrochemicals, where pyrazole derivatives are often explored for their biological activities. Additionally, the presence of the iodine atom can facilitate further functionalization, making it a valuable intermediate in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks.

Formula: C₆H₉IN₂

InChI: InChI=1/C6H9IN2/c1-4-6(7)5(2)9(3)8-4/h1-3H3

SMILES: Cc1c(c(C)n(C)n1)I

Synonyms:

• 1H-pyrazole, 4-iodo-1,3,5-trimethyl-
• 4-Iodo-1,3,5-trimethyl-1H-pyrazole

4-Iodo-1,3,5-trimethyl-1H-pyrazole

CAS: 51660-65-2

Formula: C₆H₉IN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 236.0535

Ref: IN-DA00DCNE

4-Iodo-1,3,5-trimethyl-1H-pyrazole

CAS: 51660-65-2

4-Iodo-1,3,5-trimethyl-1H-pyrazole

Formula: C₆H₉IN₂

Purity: ≥95%

Color and Shape: solid

Molecular weight: 236.05g/mol

Ref: 54-OR23239

4-Iodo-1,3,5-trimethyl-1H-pyrazole

CAS: 51660-65-2

4-Iodo-1,3,5-trimethyl-1H-pyrazole is an unsymmetrical compound that can be used in various research applications. It has the ability to oxidize certain compounds and is commonly used in laboratory settings for chemical research purposes. This versatile compound is often categorized under Research Chemicals due to its unique properties and potential applications in scientific studies.

Formula: C₆H₉IN₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 236.05 g/mol

Ref: 3D-FI34177

4-Iodo-1,3,5-trimethyl-1H-pyrazole

CAS: 51660-65-2

Purity: 95%

Molecular weight: 236.0559998

Ref: 10-F718630