CAS 5167-17-9: 3-{[benzyl(furan-2-ylmethyl)amino](1-cyclopentyl-1H-tetrazol-5-yl)methyl}-8-methylquinolin-2(1H)-one
Description:The chemical substance known as "3-{[benzyl(furan-2-ylmethyl)amino](1-cyclopentyl-1H-tetrazol-5-yl)methyl}-8-methylquinolin-2(1H)-one," with the CAS number 5167-17-9, is a complex organic compound characterized by its multi-functional structure. It features a quinoline core, which is known for its biological activity, particularly in medicinal chemistry. The presence of a benzyl group and a furan moiety suggests potential interactions with biological targets, enhancing its pharmacological properties. The cyclopentyl and tetrazole components may contribute to its lipophilicity and ability to cross biological membranes, which is crucial for drug development. This compound may exhibit various biological activities, including antimicrobial or anticancer properties, although specific activity would depend on further empirical studies. Its synthesis likely involves multiple steps, including the formation of the quinoline framework and the introduction of the various substituents. Overall, this compound represents a class of heterocyclic compounds that are of interest in pharmaceutical research due to their diverse biological activities.
Formula:C29H30N6O2
InChI:InChI=1/C29H30N6O2/c1-20-9-7-12-22-17-25(29(36)30-26(20)22)27(28-31-32-33-35(28)23-13-5-6-14-23)34(19-24-15-8-16-37-24)18-21-10-3-2-4-11-21/h2-4,7-12,15-17,23,27H,5-6,13-14,18-19H2,1H3,(H,30,36)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N,N-diethyl-9H-purin-2-amine REF: IN-DA00E0NVCAS: 5167-17-9 | 97% | 147.00 €~568.00 € | Mon 14 Apr 25 |
![]() | N,N-DIETHYL-9H-PURIN-2-AMINE REF: 10-F467680CAS: 5167-17-9 | 95.0% | To inquire | Thu 24 Apr 25 |
![]() | N,N-Diethyl-9H-purine-2-amine REF: 3D-FAA16717CAS: 5167-17-9 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA00E0NV
1g | 568.00 € | ||
100mg | 147.00 € | ||
250mg | 242.00 € | ||
500mg | 535.00 € |

Ref: 10-F467680
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

N,N-Diethyl-9H-purine-2-amine
Ref: 3D-FAA16717
1g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |