CAS 51670-40-7

Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-8-ol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, 8-acetate, (6R,7R,8R,13aS)-

Description:

Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-8-ol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, 8-acetate, with the CAS number 51670-40-7, is a complex organic compound characterized by its intricate polycyclic structure. This substance features multiple methoxy groups and an acetate functional group, contributing to its chemical reactivity and potential biological activity. The presence of stereocenters in its structure indicates that it can exist in different stereoisomeric forms, which may influence its pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their structural diversity and ability to interact with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary significantly based on its functional groups and overall molecular architecture. As with many organic compounds, understanding its characteristics requires careful consideration of its molecular interactions and potential applications in various fields, including drug development and materials science.

Formula: C₂₅H₃₀O₈

InChI: InChI=1S/C25H30O8/c1-12-8-15-9-17(27-4)22(28-5)24(29-6)19(15)20-16(21(13(12)2)33-14(3)26)10-18-23(25(20)30-7)32-11-31-18/h9-10,12-13,21H,8,11H2,1-7H3

InChI key: InChIKey=QUGMSTJBNZWXQS-UHFFFAOYSA-N

SMILES: O(C)C1=C2C=3C(=CC(OC)=C(OC)C3OC)CC(C)C(C)C(OC(C)=O)C2=CC4=C1OCO4

Synonyms:

• Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-8-ol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, acetate, stereoisomer
• Kadsurin
• Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-8-ol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, acetate, (6R,7R,8R)-(-)-
• Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-8-ol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, 8-acetate, (6R,7R,8R,13aS)-

Kadsurin

CAS: 51670-40-7

Formula: C₂₅H₃₀O₈

Purity: 95%

Color and Shape: Solid

Molecular weight: 458.5009

Ref: IN-DA00DLRN

Kadsurin

CAS: 51670-40-7

Kadsurin

Purity: ≥98%

Molecular weight: 458.5g/mol

Ref: 54-BUP07124

Kadsurin

CAS: 51670-40-7

Formula: C₂₅H₃₀O₈

Molecular weight: 458.51

Ref: 7W-GY6470

Kadsurin

CAS: 51670-40-7

Formula: C₂₅H₃₀O₈

Purity: 95%~99%

Molecular weight: 458.507

Ref: BP-BP4494

Kadsurin

CAS: 51670-40-7

Kadsurin has anti-oxidant activity, it induces enzymes capable of scavenging oxygen radical species in the liver.

Formula: C₂₅H₃₀O₈

Purity: 99.52% - 99.63%

Color and Shape: Solid

Molecular weight: 458.5

Ref: TM-TN1816

Kadsurin

Controlled Product

CAS: 51670-40-7

Kadsurin is a natural product that belongs to the genus Angelicae. It has significant cytotoxicity and can be used as a cancer medicine. Kadsurin is also hepatoprotective and can be used for the treatment of blood deficiency, iron oxides deficiency, or anemia caused by malaria. The therapeutic effects of Kadsurin are due to its ability to inhibit the drug transporter P-glycoprotein on the cell membrane surface.

Formula: C₂₅H₃₀O₈

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 458.5 g/mol

Ref: 3D-XK178297