CymitQuimica logo

CAS 51674-05-6

:

(E)-(2-aminophenyl)(phenyl)methanone oxime

Description:
(E)-(2-aminophenyl)(phenyl)methanone oxime, with the CAS number 51674-05-6, is an organic compound characterized by its oxime functional group, which is derived from the reaction of a ketone with hydroxylamine. This compound features a phenyl group and an amino group attached to a central carbon, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The oxime functionality can also engage in tautomeric shifts, which may affect its stability and reactivity under different conditions. Typically, compounds like this may exhibit properties such as moderate to high melting points and solubility in polar solvents, depending on their specific structure and substituents. Additionally, due to the presence of both aromatic and functional groups, it may show interesting interactions in biological systems, making it a candidate for further research in medicinal chemistry or material science. However, specific physical and chemical properties would need to be determined experimentally.
Formula:C13H12N2O
InChI:InChI=1/C13H12N2O/c14-12-9-5-4-8-11(12)13(15-16)10-6-2-1-3-7-10/h1-9,16H,14H2/b15-13+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.