CAS 51674-77-2

4-Chloropyrido[3,2-d]pyrimidine

Description:

4-Chloropyrido[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, with a chlorine substituent at the 4-position of the pyridine ring. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its ability to interact with biological targets. The presence of the chlorine atom can influence its reactivity and solubility, making it a useful intermediate in organic synthesis. Additionally, 4-Chloropyrido[3,2-d]pyrimidine may exhibit various biological activities, including antimicrobial and anticancer properties, which are subjects of ongoing research. Its molecular structure contributes to its unique chemical properties, including its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. As with many heterocycles, it is important to handle this compound with care, following appropriate safety protocols due to potential toxicity and reactivity.

Formula: C₇H₄ClN₃

InChI: InChI=1/C7H4ClN3/c8-7-6-5(10-4-11-7)2-1-3-9-6/h1-4H

SMILES: c1cc2c(c(Cl)ncn2)nc1

Synonyms:

• Pyrido[3,2-D]Pyrimidine, 4-Chloro-

Pyrido[3,2-d]pyrimidine, 4-chloro-

CAS: 51674-77-2

Formula: C₇H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.5798

Ref: IN-DA00D80J

4-Chloropyrido[3,2-d]pyrimidine

CAS: 51674-77-2

4-Chloropyrido[3,2-d]pyrimidine

Purity: 97%

Molecular weight: 165.58g/mol

Ref: 54-OR79686

4-CHLOROPYRIDO[3,2-D]PYRIMIDINE

CAS: 51674-77-2

Formula: C₇H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.58

Ref: 10-F472360