CAS 51679-42-6
:2-({4-[(trifluoromethyl)sulfanyl]phenyl}amino)benzoic acid
Description:
2-({4-[(Trifluoromethyl)sulfanyl]phenyl}amino)benzoic acid, with the CAS number 51679-42-6, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming salts or esters. The presence of a trifluoromethyl group (-CF3) attached to a sulfur atom (sulfanyl) enhances its lipophilicity and may influence its reactivity and biological activity. The compound's amino group (-NH2) allows for hydrogen bonding, which can affect solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for various applications in medicinal chemistry. Additionally, the trifluoromethyl group is known to impart stability and alter the electronic properties of the molecule, potentially affecting its behavior in chemical reactions. Overall, this compound's characteristics suggest it may have relevance in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C14H10F3NO2S
InChI:InChI=1/C14H10F3NO2S/c15-14(16,17)21-10-7-5-9(6-8-10)18-12-4-2-1-3-11(12)13(19)20/h1-8,18H,(H,19,20)
SMILES:c1ccc(c(c1)C(=O)O)Nc1ccc(cc1)SC(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
