CAS 51690-67-6

4-(4-ethoxyphenoxy)aniline

Description:

4-(4-Ethoxyphenoxy)aniline, with the CAS number 51690-67-6, is an organic compound characterized by its aromatic structure, which includes an aniline group and an ether linkage to a para-ethoxyphenyl moiety. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the presence of aromatic rings. The ethoxy group enhances its solubility in non-polar solvents while providing some steric hindrance, which can influence its reactivity and interaction with other chemical species. The presence of the amino group (-NH2) in the aniline part of the molecule allows for potential hydrogen bonding and reactivity in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, compounds like this may exhibit biological activity, which can be explored in pharmaceutical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1/C14H15NO2/c1-2-16-12-7-9-14(10-8-12)17-13-5-3-11(15)4-6-13/h3-10H,2,15H2,1H3

SMILES: CCOc1ccc(cc1)Oc1ccc(cc1)N

Synonyms:

• 4-(4-Ethoxy-phenoxy)-phenylamine
• Benzenamine, 4-(4-Ethoxyphenoxy)-

4-(4-Ethoxyphenoxy)aniline

CAS: 51690-67-6

Versatile small molecule scaffold

Formula: C₁₄H₁₅NO₂

Purity: Min. 95%

Molecular weight: 229.27 g/mol

Ref: 3D-BCA69067