CAS 51699-89-9
:1,3-Dibromo-2-methoxy-5-methylbenzene
Description:
1,3-Dibromo-2-methoxy-5-methylbenzene, also known by its CAS number 51699-89-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms, a methoxy group (-OCH3), and a methyl group (-CH3). The presence of the bromine atoms introduces significant reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The methoxy group contributes to the compound's solubility in organic solvents and can influence its electronic properties, enhancing its reactivity in electrophilic aromatic substitution reactions. The methyl group, being a sterically bulky substituent, can affect the compound's overall steric hindrance and reactivity. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample.
Formula:C8H8Br2O
InChI:InChI=1S/C8H8Br2O/c1-5-3-6(9)8(11-2)7(10)4-5/h3-4H,1-2H3
InChI key:InChIKey=IHOLQYYMMKYVLH-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)C=C(C)C=C1Br
Synonyms:- 1,3-Dibromo-2-Methoxy-5-Methylbenzene
- 2,6-Dibromo-4-methylmethoxybenzene
- Benzene, 1,3-dibromo-2-methoxy-5-methyl-
- 2,6-Dibromo-4-methylanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Dibromo-4-methylanisole
CAS:Formula:C8H8Br2OPurity:97%Color and Shape:LiquidMolecular weight:279.95652,6-Dibromo-4-methylanisole
CAS:2,6-Dibromo-4-methylanisoleFormula:C8H8Br2OPurity:98%Color and Shape: clear. colourless liquidMolecular weight:279.96g/mol2,6-Dibromo-4-Methylanisole
CAS:2,6-Dibromo-4-Methylanisole is a methoxylated compound that can be used to produce enantiopure compounds. It is an intermediate in the synthesis of 2,4-dichlorobenzophenone and 2,6-dichloro-4-(methylthio)phenol. The reactivity of this compound is due to its ability to form hydrogen bonding interactions with transition metal ions such as nickel(II). Methylation by 2,6-dibromo-4-methylanisole can also be achieved using other methylating agents such as methyl iodide or dimethyl sulfate. This compound has a polydentate structure which means that it can coordinate with multiple metal ions at once. Steric interactions are also important for the reactivity of this compound. Debromination is an important reaction in the synthesis of 2,6-dibromo-4-(methylthFormula:C8H8Br2OPurity:Min. 95%Molecular weight:279.96 g/mol



