CAS 51707-38-1
:3,4-Dimethoxybenzhydrazide
Description:
3,4-Dimethoxybenzhydrazide is an organic compound characterized by its hydrazide functional group attached to a benzene ring that is further substituted with two methoxy groups at the 3 and 4 positions. This compound typically appears as a crystalline solid and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic structure. The presence of the methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions in various chemical environments. 3,4-Dimethoxybenzhydrazide may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. Its synthesis generally involves the reaction of 3,4-dimethoxybenzoic acid with hydrazine or its derivatives. As with many hydrazides, it may participate in various chemical reactions, including condensation and oxidation, which can be utilized in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as with all chemicals, due to potential toxicity and reactivity.
Formula:C9H12N2O3
InChI:InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12)
SMILES:COc1cc(cc(c1)OC)C(=NN)O
Synonyms:- 3,5-Dimethoxybenzohydrazide
- 3,5-Dimethoxybenzhydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3,5-dimethoxy-, hydrazide
CAS:Formula:C9H12N2O3Purity:98%Color and Shape:SolidMolecular weight:196.20323,5-Dimethoxybenzhydrazide
CAS:Formula:C9H12N2O3Purity:98%Color and Shape:SolidMolecular weight:196.2063,5-Dimethoxybenzhydrazide
CAS:3,5-Dimethoxybenzhydrazide is a combretastatin analogue that binds to tubulin to disrupt the polymerization of microtubules. It has been shown to inhibit tumor cell growth in vitro and in vivo. 3,5-Dimethoxybenzhydrazide has an IC50 of 10 nM for tubulin polymerization, which is significantly lower than colchicine (IC50 of 0.2 μM). This drug also interacts with colchicine binding sites and has a selectivity index of 1.3.
Formula:C9H12N2O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:196.2 g/molRef: 3D-FD70702
Discontinued product




