CAS 51716-96-2
:3-Amino-7-(diethylamino)-2-methylphenoxazin-5-ium (T-4)-tetrachlorozincate(2-) (2:1)
Description:
3-Amino-7-(diethylamino)-2-methylphenoxazin-5-ium (T-4)-tetrachlorozincate(2-) is a complex organic-inorganic compound characterized by its unique structure, which includes a phenoxazine core modified with amino and diethylamino groups. This compound typically exhibits a vibrant color due to the presence of the phenoxazine moiety, which is known for its strong chromophoric properties. The tetrachlorozincate(2-) component indicates the presence of zinc ions coordinated with four chloride ions, contributing to the compound's stability and solubility in various solvents. The presence of amino groups suggests potential for hydrogen bonding and reactivity, making it useful in various applications, including dye chemistry and as a potential biological probe. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the pH and the solvent environment. Overall, this substance is of interest in both synthetic and applied chemistry due to its unique structural features and potential applications in materials science and biochemistry.
Formula:C17H20N3OCl4Zn
InChI:InChI=1S/C17H20N3O.4ClH.Zn/c1-4-20(5-2)12-6-7-14-16(9-12)21-17-10-13(18)11(3)8-15(17)19-14;;;;;/h6-10H,4-5,18H2,1-3H3;4*1H;/q+1;;;;;+2/p-4
InChI key:InChIKey=FJQKUIRBTQXQOV-UHFFFAOYSA-J
SMILES:N(CC)(CC)C1=CC2=C(N=C3C(=[O+]2)C=C(N)C(C)=C3)C=C1.[Zn+2]([Cl-])([Cl-])([Cl-])[Cl-]
Synonyms:- Ethanaminium, N-(7-amino-8-methyl-3H-phenoxazin-3-ylidene)-N-ethyl-, (T-4)-tetrachlorozincate(2-) (2:1)
- bis[3-amino-7-(diethylamino)-2-methylphenoxazin-5-ium] tetrachlorozincate(2-)
- 3-Amino-7-(diethylamino)-2-methylphenoxazin-5-ium (T-4)-tetrachlorozincate(2-) (2:1)
- Zincate(2-), tetrachloro-, (T-4)-, bis[3-amino-7-(diethylamino)-2-methylphenoxazin-5-ium]
- ethanaminium, N-(7-amino-8-methyl-3H-phenoxazin-3-ylidene)-N-ethyl-, dichloride, zinc salt (2:1)
- Zincate(2-), tetrachloro-, (T-4)-, bis[N-(7-amino-8-methyl-3H-phenoxazin-3-ylidene)-N-ethylethanaminium]
- Phenoxazin-5-ium, 3-amino-7-(diethylamino)-2-methyl-, (T-4)-tetrachlorozincate(2-) (2:1)
- 3-Amino-7-(diethylamino)-2-methylphenoxazin-5-ium tetrachlorozincate (2:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Brilliant Cresyl Blue ALD
CAS:Brilliant Cresyl Blue ALD is a model system for the study of oocyte maturation and fertilization. The sensor is a bovine capillary blood cell that has been genetically modified to express the protein cresyl. The sensor is used in conjunction with an electrode to measure changes in electrochemical impedance as the oocytes mature, which can be used to predict when eggs are ready for fertilization. The injection solution contains cresyl blue dye and is injected into blastocysts to stain mitochondria, which can be observed using optical sensors.
Formula:C17H20N3OClZnCl2Purity:Min. 95%Molecular weight:385.96 g/mol

