CAS 51729-83-0
:Methyl isopropyl carbonate
Description:
Methyl isopropyl carbonate, with the CAS number 51729-83-0, is an organic compound classified as a carbonate ester. It is typically a colorless liquid with a mild, pleasant odor. This compound is characterized by its relatively low viscosity and moderate volatility, making it suitable for various applications in the chemical industry. Methyl isopropyl carbonate is known for its good solvency properties, which allow it to dissolve a range of organic compounds, making it useful as a solvent in coatings, adhesives, and other formulations. Additionally, it exhibits low toxicity and is considered to have a favorable environmental profile compared to some traditional solvents. Its chemical structure includes a methyl group and an isopropyl group attached to a carbonate functional group, contributing to its reactivity and utility in organic synthesis. As with many chemical substances, proper handling and safety precautions should be observed to mitigate any potential risks associated with exposure.
Formula:C5H10O3
InChI:InChI=1/C5H10O3/c1-4(2)8-5(6)7-3/h4H,1-3H3
SMILES:CC(C)OC(=O)OC
Synonyms:- Methyl 1-Methylethyl Carbonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl isopropyl carbonate, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H10O3Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:118.13
