
CAS 51736-76-6
:6′′-O-Carbamoylkanamycin B
Description:
6′′-O-Carbamoylkanamycin B is a semi-synthetic derivative of kanamycin, an aminoglycoside antibiotic. This compound is characterized by the presence of a carbamoyl group at the 6′′ position of the kanamycin B structure, which enhances its antibacterial activity against a range of Gram-negative and some Gram-positive bacteria. The modification aims to improve the pharmacological properties, such as solubility and stability, while potentially reducing toxicity. Like other aminoglycosides, it exerts its antimicrobial effect by binding to the bacterial ribosome, inhibiting protein synthesis. The molecular structure includes multiple hydroxyl groups, contributing to its solubility in water, and the presence of nitrogen atoms in the carbamoyl group plays a crucial role in its biological activity. 6′′-O-Carbamoylkanamycin B is primarily used in research and may have applications in treating infections caused by resistant bacterial strains. As with other antibiotics, the emergence of resistance is a concern, necessitating ongoing studies to evaluate its efficacy and safety in clinical settings.
Formula:C19H38N6O11
InChI:InChI=1S/C19H38N6O11/c20-2-6-11(27)12(28)9(24)17(33-6)35-15-4(21)1-5(22)16(14(15)30)36-18-13(29)8(23)10(26)7(34-18)3-32-19(25)31/h4-18,26-30H,1-3,20-24H2,(H2,25,31)/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1
InChI key:InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-N
SMILES:O([C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N)[C@H]3O[C@H](COC(N)=O)[C@@H](O)[C@H](N)[C@H]3O
Synonyms:- D-Streptamine, O-3-amino-6-O-(aminocarbonyl)-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-
- O-3-Amino-6-O-(aminocarbonyl)-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-D-streptamine
- 6′′-O-Carbamoylkanamycin B
- Nebramycin IV
- Nebramycin factor 4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nebramycin Ⅳ
CAS:Nebramycin IV is an aminoglycoside antibiotic with a broad antimicrobial spectrum, demonstrating significant efficacy against Gram-positive bacteria, Gram-negative bacteria, and mycobacteria.Formula:C19H38N6O11Color and Shape:SolidMolecular weight:526.539

