CymitQuimica logo

CAS 51746-87-3

:

Pyridine, 4-(1H-imidazol-4-yl)-

Description:
Pyridine, 4-(1H-imidazol-4-yl)-, also known by its CAS number 51746-87-3, is a heterocyclic organic compound that features a pyridine ring substituted with an imidazole group. This compound exhibits characteristics typical of both pyridine and imidazole derivatives, including basicity due to the nitrogen atoms in both rings, which can participate in protonation and coordination with metal ions. It is generally soluble in polar solvents, reflecting the presence of nitrogen atoms that can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. Additionally, the presence of both aromatic systems contributes to its stability and reactivity, making it a versatile building block in organic synthesis. Overall, pyridine, 4-(1H-imidazol-4-yl)- is a significant compound in both academic research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c1-3-9-4-2-7(1)8-5-10-6-11-8/h1-6H,(H,10,11)
InChI key:AJQQGJNKKDEODG-UHFFFAOYSA-N
SMILES:C1=CN=CC=C1C2=CN=CN2
Synonyms:
  • 4-(1H-imidazol-4-yl)pyridine
Found 5 products.