CAS 51752-67-1

4-Chloropyrido[3,4-d]pyrimidine

Description:

4-Chloropyrido[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, with a chlorine substituent at the 4-position of the pyridine ring. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine atom can influence its reactivity and solubility, often enhancing its lipophilicity. 4-Chloropyrido[3,4-d]pyrimidine may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine atom. Its structural features allow for interactions with biological targets, which can lead to various pharmacological effects. As with many heterocycles, it may also exhibit fluorescence properties, making it useful in certain analytical applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₄ClN₃

InChI: InChI=1/C7H4ClN3/c8-7-5-1-2-9-3-6(5)10-4-11-7/h1-4H

SMILES: c1cncc2c1c(Cl)ncn2

Synonyms:

• Pyrido[3,4-D]Pyrimidine, 4-Chloro-

Pyrido[3,4-d]pyrimidine, 4-chloro-

CAS: 51752-67-1

Formula: C₇H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.5798

Ref: IN-DA00D80P

4-Chloropyrido[3,4-d]pyrimidine

CAS: 51752-67-1

4-Chloropyrido[3,4-d]pyrimidine

Purity: 95%

Molecular weight: 165.58g/mol

Ref: 54-OR902458

4-Chloropyrido[3,4-d]pyrimidine

CAS: 51752-67-1

Formula: C₇H₄ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 165.58

Ref: 10-F076226