CAS 5176-22-7

1-azabicyclo[2.2.2]oct-3-ylmethanol

Description:

1-Azabicyclo[2.2.2]oct-3-ylmethanol, with the CAS number 5176-22-7, is a bicyclic organic compound characterized by its unique bicyclic structure that includes a nitrogen atom within the ring system. This compound features a hydroxymethyl group (-CH2OH) attached to the bicyclic framework, which contributes to its reactivity and potential as a building block in organic synthesis. The presence of the nitrogen atom imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. The bicyclic structure provides rigidity and can influence the compound's conformational preferences, affecting its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and drug design due to its structural features, which can be tailored for specific biological targets. Overall, 1-azabicyclo[2.2.2]oct-3-ylmethanol exemplifies the complexity and versatility of bicyclic amines in organic chemistry.

Formula: C₈H₁₅NO

InChI: InChI=1/C8H15NO/c10-6-8-5-9-3-1-7(8)2-4-9/h7-8,10H,1-6H2

SMILES: C1CN2CCC1C(C2)CO

Synonyms:

• 1-Azabicyclo[2.2.2]Octane-3-Methanol
• 3-Hydroxymethylquinuclidine

Quinuclidin-3-ylmethanol

CAS: 5176-22-7

Formula: C₈H₁₅NO

Molecular weight: 141.2108

Ref: IN-DA00DBEC

{1-Azabicyclo[2.2.2]octan-3-yl}methanol

CAS: 5176-22-7

{1-Azabicyclo[2.2.2]octan-3-yl}methanol is a dehydrating agent that is used in the production of many organic and inorganic chemicals, such as chlorides, alcohols, amines, ethers, and thiols. This chemical has been shown to react with alkali metals to produce hydrogen chloride gas. It has also been used as an antihistaminic and for dehydrating reactions. {1-Azabicyclo[2.2.2]octan-3-yl}methanol can be used to manufacture hydrogen chloride gas by reacting with sodium hydroxide or potassium hydroxide at high temperatures. The reaction product is then dehydrated to form hydrochloric acid (HCl).

Formula: C₈H₁₅NO

Purity: Min. 95%

Molecular weight: 141.21 g/mol

Ref: 3D-FAA17622