CAS 5176-30-7
:1,2,3,4-tetrahydro-1,4-epiminonaphthalene
Description:
1,2,3,4-Tetrahydro-1,4-epiminonaphthalene, with the CAS number 5176-30-7, is a bicyclic organic compound characterized by its unique structure that includes a naphthalene core modified by the presence of a tetrahydro group and an imine functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the imine group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, its bicyclic structure may influence its physical properties, such as boiling point and solubility, making it of interest in materials science and medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested.
Formula:C10H11N
InChI:InChI=1/C10H11N/c1-2-4-8-7(3-1)9-5-6-10(8)11-9/h1-4,9-11H,5-6H2
SMILES:c1ccc2c(c1)C1CCC2N1
Synonyms:- 11-Azatricyclo(6.2.1.0(2,7))undec-2,4,6-triene
- 11-Azatricyclo[6.2.1.02,7]Undeca-2,4,6-Triene
- Naphthalen-1,4-Imine, 1,2,3,4-Tetrahydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,2,3,4-Tetrahydro-naphthalen-1,4-imine
CAS:<p>1,2,3,4-Tetrahydro-naphthalen-1,4-imine is a protease inhibitor that belongs to the pyrrole class of compounds. It has been shown to inhibit the activity of proteases like chymotrypsin and elastase by binding to their active site. This inhibition prevents hydrolysis of protein substrates and prevents them from being degraded. The compound was optimized for use as a protease inhibitor by incorporating hydrophobic moieties and ionic groups into its structure. The conformational flexibility in its structure also makes it an efficient catalyst for reactions involving benzyne intermediates. 1,2,3,4-Tetrahydro-naphthalen-1,4-imine is activated at the linker level by aspartic acid residues in its active site. This activation aids in catalysis by stabilizing the transition state of substrate molecules with respect to the transition state of</p>Formula:C10H11NPurity:Min. 95%Molecular weight:145.2 g/mol
