CAS 51760-04-4

1-bromo-4-fluoro-2,5-dimethylbenzene

Description:

1-Bromo-4-fluoro-2,5-dimethylbenzene, with the CAS number 51760-04-4, is an aromatic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with two methyl groups. This compound features a bromine atom at the first position and a fluorine atom at the fourth position of the benzene ring, while the methyl groups are located at the second and fifth positions. The presence of these substituents influences its chemical reactivity, polarity, and overall stability. Typically, such halogenated aromatic compounds exhibit unique properties, including increased reactivity in electrophilic substitution reactions and potential applications in organic synthesis and materials science. The compound may also possess specific physical properties such as boiling and melting points, which are influenced by the steric effects of the methyl groups and the electronegativity of the halogens. Additionally, its environmental and health impacts should be considered, as halogenated compounds can exhibit varying degrees of toxicity and persistence in the environment.

Formula: C₈H₈BrF

InChI: InChI=1/C8H8BrF/c1-5-4-8(10)6(2)3-7(5)9/h3-4H,1-2H3

SMILES: Cc1cc(c(C)cc1Br)F

Synonyms:

• Benzene, 1-bromo-4-fluoro-2,5-dimethyl-
• 1-Bromo-4-fluoro-2,5-dimethylbenzene

1-BROMO-4-FLUORO-2,5-DIMETHYLBENZENE

CAS: 51760-04-4

Formula: C₈H₈BrF

Purity: 96%

Color and Shape: Liquid

Molecular weight: 203.0515

Ref: IN-DA003E4V

1-Bromo-2,5-dimethyl-4-fluorobenzene

CAS: 51760-04-4

1-Bromo-2,5-dimethyl-4-fluorobenzene

Purity: 97%

Molecular weight: 203.05g/mol

Ref: 54-PC51180

4-Bromo-2,5-dimethylfluorobenzene

CAS: 51760-04-4

Formula: C₈H₈BrF

Purity: 96%

Color and Shape: Liquid

Molecular weight: 203.054

Ref: 10-F037508