CAS 51765-51-6
:2′-Phenoxymethanesulfonanilide
Description:
2′-Phenoxymethanesulfonanilide, with the CAS number 51765-51-6, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a phenoxy group, indicating the presence of a phenol derivative, and a methanesulfonamide moiety, which contributes to its solubility and reactivity. Typically, sulfonamides like this one exhibit moderate to high polarity due to the sulfonamide and phenoxy groups, making them soluble in polar solvents. The compound may also possess biological activity, often being investigated for its potential therapeutic applications. Its structure suggests it could interact with biological systems, potentially inhibiting specific enzymes or pathways. Additionally, the presence of the sulfonamide group may confer properties such as antimicrobial activity, which is a common characteristic of many sulfonamide derivatives. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C13H13NO3S
InChI:InChI=1S/C13H13NO3S/c1-18(15,16)14-12-9-5-6-10-13(12)17-11-7-3-2-4-8-11/h2-10,14H,1H3
InChI key:InChIKey=WSFHNGGYRUTXFN-UHFFFAOYSA-N
SMILES:O(C1=C(NS(C)(=O)=O)C=CC=C1)C2=CC=CC=C2
Synonyms:- (2-Phenoxy)Methylsulfonylaniline
- 2′-Phenoxymethanesulfonanilide
- Methanesulfonamide, N-(2-phenoxyphenyl)-
- N-(2-phenoxyphenyl)methanesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
(2-PHENOXY)METHYLSULFONYLANILINE
CAS:Formula:C13H13NO3SPurity:97%Color and Shape:SolidMolecular weight:263.3122Nimesulide EP Impurity B
CAS:Formula:C13H13NO3SColor and Shape:White To Off-White SolidMolecular weight:263.31N-(2-Phenoxyphenyl)methanesulphonamide
CAS:Controlled ProductFormula:C13H13NO3SColor and Shape:NeatMolecular weight:263.31Neratinib Impurity 5
CAS:Formula:C26H20ClN5O5Color and Shape:White To Off-White SolidMolecular weight:517.932'-Phenoxymethanesulfonanilide
CAS:Controlled ProductFormula:C13H13NO3SColor and Shape:White To Off-WhiteMolecular weight:263.312-((Phenoxymethyl)sulfonyl)aniline
CAS:2-((Phenoxymethyl)sulfonyl) aniline is a pharmacological agent that is used to treat inflammatory diseases. It has been shown to be effective in the treatment of rheumatoid arthritis, ulcerative colitis, and Crohn's disease. The drug acts by reducing the production of prostaglandins (e.g., PGE2), which are responsible for inflammation. 2-((Phenoxymethyl)sulfonyl) aniline is administered orally as a sodium salt or intravenously as a granule formulation. This drug can also be used to produce injectable solutions or tablets with lysine.
Formula:C13H13NO3SPurity:Min. 95%Molecular weight:263.31 g/mol







