CAS 51769-43-8

2-(Methylthio)naphtho[1,2-d]thiazole

Description:

2-(Methylthio)naphtho[1,2-d]thiazole is an organic compound characterized by its unique structure, which includes a naphthalene moiety fused with a thiazole ring and a methylthio group. This compound typically exhibits a yellow to brown color and is known for its aromatic properties due to the presence of the naphthalene structure. It is often used in various chemical applications, including as a building block in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. The thiazole ring contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry. Additionally, the methylthio group can influence the compound's solubility and stability. As with many thiazole derivatives, it may exhibit fluorescence, which can be useful in analytical applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact. Overall, 2-(Methylthio)naphtho[1,2-d]thiazole is a compound of interest in both research and industrial contexts.

Formula: C₁₂H₉NS₂

InChI: InChI=1S/C12H9NS2/c1-14-12-13-11-9-5-3-2-4-8(9)6-7-10(11)15-12/h2-7H,1H3

InChI key: InChIKey=NCJSBVUUUHBCQS-UHFFFAOYSA-N

SMILES: S(C)C1=NC=2C=3C(C=CC2S1)=CC=CC3

Synonyms:

• 2-(Methylsulfanyl)naphtho[1,2-d][1,3]thiazole
• 2-(Methylthio)naphtho[1,2-d]thiazole
• Naphtho(1,2-d)thiazole, 2-(methylthio)-

2-(Methylthio)naphtho[1,2-d]thiazole

CAS: 51769-43-8

Formula: C₁₂H₉NS₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 231.33

Ref: 3B-M1827

2-(Methylthio)-β-naphthothiazole

CAS: 51769-43-8

Formula: C₁₂H₉NS₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 231.3366

Ref: IN-DA003F3J